C16H18ClF2N7O2 — CID 139304802
tert-butyl N-[(1S)-2-azido-1-[4-chloro-3-[5-(difluoromethyl)-1,2,4-triazol-1-yl]phenyl]ethyl]carbamate (PubChem CID 139304802) has the molecular formula C16H18ClF2N7O2 and a molecular weight of 413.82 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-azido-1-[4-chloro-3-[5-(difluoromethyl)-1,2,4-triazol-1-yl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-azido-1-[4-chloro-3-[5-(difluoromethyl)-1,2,4-triazol-1-yl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 139304802 |
| Molecular Formula | C16H18ClF2N7O2 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | tert-butyl N-[(1S)-2-azido-1-[4-chloro-3-[5-(difluoromethyl)-1,2,4-triazol-1-yl]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CN=[N+]=[N-])c1ccc(Cl)c(-n2ncnc2C(F)F)c1 |
| InChI | InChI=1S/C16H18ClF2N7O2/c1-16(2,3)28-15(27)24-11(7-22-25-20)9-4-5-10(17)12(6-9)26-14(13(18)19)21-8-23-26/h4-6,8,11,13H,7H2,1-3H3,(H,24,27)/t11-/m1/s1 |
| InChIKey | LPXUXHCOLQBOGO-LLVKDONJSA-N |
| XLogP | 4.73 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|