C14H18FNO2 — CID 138738593
(1R)-6-fluoro-1-[(2S)-piperidin-2-yl]-3,4-dihydroisochromen-1-ol (PubChem CID 138738593) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is (1R)-6-fluoro-1-[(2S)-piperidin-2-yl]-3,4-dihydroisochromen-1-ol.
| Compound Name | (1R)-6-fluoro-1-[(2S)-piperidin-2-yl]-3,4-dihydroisochromen-1-ol |
|---|---|
| PubChem CID | 138738593 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (1R)-6-fluoro-1-[(2S)-piperidin-2-yl]-3,4-dihydroisochromen-1-ol |
| SMILES | O[C@@]1([C@@H]2CCCCN2)OCCc2cc(F)ccc21 |
| InChI | InChI=1S/C14H18FNO2/c15-11-4-5-12-10(9-11)6-8-18-14(12,17)13-3-1-2-7-16-13/h4-5,9,13,16-17H,1-3,6-8H2/t13-,14+/m0/s1 |
| InChIKey | VGJFHYJLXAQKOH-UONOGXRCSA-N |
| XLogP | 1.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |