C18H14Cl2N6 — CID 138740842
3-[(2,6-dichlorophenyl)methyl]-N-(pyridin-2-ylmethyl)-7H-purin-6-imine (PubChem CID 138740842) has the molecular formula C18H14Cl2N6 and a molecular weight of 385.26 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]-N-(pyridin-2-ylmethyl)-7H-purin-6-imine.
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]-N-(pyridin-2-ylmethyl)-7H-purin-6-imine |
|---|---|
| PubChem CID | 138740842 |
| Molecular Formula | C18H14Cl2N6 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]-N-(pyridin-2-ylmethyl)-7H-purin-6-imine |
| SMILES | Clc1cccc(Cl)c1Cn1cn/c(=N\Cc2ccccn2)c2[nH]cnc21 |
| InChI | InChI=1S/C18H14Cl2N6/c19-14-5-3-6-15(20)13(14)9-26-11-25-17(16-18(26)24-10-23-16)22-8-12-4-1-2-7-21-12/h1-7,10-11H,8-9H2,(H,23,24)/b22-17- |
| InChIKey | QTUKDFPRGDISBY-XLNRJJMWSA-N |
| XLogP | 3.61 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |