C12H16NO7P — CID 138740955
methyl 4-[(2-phosphonooxypropanoylamino)methyl]benzoate (PubChem CID 138740955) has the molecular formula C12H16NO7P and a molecular weight of 317.23 g/mol. Its IUPAC name is methyl 4-[(2-phosphonooxypropanoylamino)methyl]benzoate.
| Compound Name | methyl 4-[(2-phosphonooxypropanoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 138740955 |
| Molecular Formula | C12H16NO7P |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | methyl 4-[(2-phosphonooxypropanoylamino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)C(C)OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C12H16NO7P/c1-8(20-21(16,17)18)11(14)13-7-9-3-5-10(6-4-9)12(15)19-2/h3-6,8H,7H2,1-2H3,(H,13,14)(H2,16,17,18) |
| InChIKey | ASCIBKYLJUDAOB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|