C24H16N6O5 — CID 138741012
4-[4-[3-[1-(4-carboxyphenyl)triazol-4-yl]phenyl]triazol-1-yl]-2-hydroxybenzoic acid (PubChem CID 138741012) has the molecular formula C24H16N6O5 and a molecular weight of 468.43 g/mol. Its IUPAC name is 4-[4-[3-[1-(4-carboxyphenyl)triazol-4-yl]phenyl]triazol-1-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[4-[3-[1-(4-carboxyphenyl)triazol-4-yl]phenyl]triazol-1-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 138741012 |
| Molecular Formula | C24H16N6O5 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 4-[4-[3-[1-(4-carboxyphenyl)triazol-4-yl]phenyl]triazol-1-yl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(-n2cc(-c3cccc(-c4cn(-c5ccc(C(=O)O)c(O)c5)nn4)c3)nn2)cc1 |
| InChI | InChI=1S/C24H16N6O5/c31-22-11-18(8-9-19(22)24(34)35)30-13-21(26-28-30)16-3-1-2-15(10-16)20-12-29(27-25-20)17-6-4-14(5-7-17)23(32)33/h1-13,31H,(H,32,33)(H,34,35) |
| InChIKey | FHBNNCPXIUINRN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 156.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |