C8H6N4O3 — CID 855909
2-hydroxy-4-(tetrazol-1-yl)benzoic acid (PubChem CID 855909) has the molecular formula C8H6N4O3 and a molecular weight of 206.16 g/mol. Its IUPAC name is 2-hydroxy-4-(tetrazol-1-yl)benzoic acid.
| Compound Name | 2-hydroxy-4-(tetrazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 855909 |
| Molecular Formula | C8H6N4O3 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-hydroxy-4-(tetrazol-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-n2cnnn2)cc1O |
| InChI | InChI=1S/C8H6N4O3/c13-7-3-5(12-4-9-10-11-12)1-2-6(7)8(14)15/h1-4,13H,(H,14,15) |
| InChIKey | WIOFQADFRFYOGG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |