C8H6N8O — CID 29060335
2,4-bis(tetrazol-1-yl)phenol (PubChem CID 29060335) has the molecular formula C8H6N8O and a molecular weight of 230.19 g/mol. Its IUPAC name is 2,4-bis(tetrazol-1-yl)phenol.
| Compound Name | 2,4-bis(tetrazol-1-yl)phenol |
|---|---|
| PubChem CID | 29060335 |
| Molecular Formula | C8H6N8O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2,4-bis(tetrazol-1-yl)phenol |
| SMILES | Oc1ccc(-n2cnnn2)cc1-n1cnnn1 |
| InChI | InChI=1S/C8H6N8O/c17-8-2-1-6(15-4-9-11-13-15)3-7(8)16-5-10-12-14-16/h1-5,17H |
| InChIKey | DBEGHQUYOXGNSP-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |