C14H15N7O2S2 — CID 131939802
2-hydroxy-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-4-(tetrazol-1-yl)benzamide (PubChem CID 131939802) has the molecular formula C14H15N7O2S2 and a molecular weight of 377.46 g/mol. Its IUPAC name is 2-hydroxy-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-4-(tetrazol-1-yl)benzamide.
| Compound Name | 2-hydroxy-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 131939802 |
| Molecular Formula | C14H15N7O2S2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 2-hydroxy-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-4-(tetrazol-1-yl)benzamide |
| SMILES | Cc1nnc(SCCCNC(=O)c2ccc(-n3cnnn3)cc2O)s1 |
| InChI | InChI=1S/C14H15N7O2S2/c1-9-17-18-14(25-9)24-6-2-5-15-13(23)11-4-3-10(7-12(11)22)21-8-16-19-20-21/h3-4,7-8,22H,2,5-6H2,1H3,(H,15,23) |
| InChIKey | WSCVCATVXNTLBJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|