C27H41N3O4S — CID 138741421
N-(4-ethylphenyl)-4-hydrazinyl-N-(2-methylpropyl)-3-[1-(oxan-4-ylmethoxy)propyl]benzenesulfonamide (PubChem CID 138741421) has the molecular formula C27H41N3O4S and a molecular weight of 503.71 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-hydrazinyl-N-(2-methylpropyl)-3-[1-(oxan-4-ylmethoxy)propyl]benzenesulfonamide.
| Compound Name | N-(4-ethylphenyl)-4-hydrazinyl-N-(2-methylpropyl)-3-[1-(oxan-4-ylmethoxy)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138741421 |
| Molecular Formula | C27H41N3O4S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | N-(4-ethylphenyl)-4-hydrazinyl-N-(2-methylpropyl)-3-[1-(oxan-4-ylmethoxy)propyl]benzenesulfonamide |
| SMILES | CCc1ccc(N(CC(C)C)S(=O)(=O)c2ccc(NN)c(C(CC)OCC3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C27H41N3O4S/c1-5-21-7-9-23(10-8-21)30(18-20(3)4)35(31,32)24-11-12-26(29-28)25(17-24)27(6-2)34-19-22-13-15-33-16-14-22/h7-12,17,20,22,27,29H,5-6,13-16,18-19,28H2,1-4H3 |
| InChIKey | LNDUHXIIQWBBOX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|