C25H35N3O3S — CID 137446211
4-[[(Z)-ethylideneamino]-(oxolan-3-ylmethyl)amino]-N-(4-ethylphenyl)-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 137446211) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is 4-[[(Z)-ethylideneamino]-(oxolan-3-ylmethyl)amino]-N-(4-ethylphenyl)-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-[[(Z)-ethylideneamino]-(oxolan-3-ylmethyl)amino]-N-(4-ethylphenyl)-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 137446211 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 4-[[(Z)-ethylideneamino]-(oxolan-3-ylmethyl)amino]-N-(4-ethylphenyl)-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | C/C=N\N(CC1CCOC1)c1ccc(S(=O)(=O)N(CC(C)C)c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C25H35N3O3S/c1-5-21-7-9-24(10-8-21)28(17-20(3)4)32(29,30)25-13-11-23(12-14-25)27(26-6-2)18-22-15-16-31-19-22/h6-14,20,22H,5,15-19H2,1-4H3/b26-6- |
| InChIKey | DNXYKKHEHMWMPL-RROVHIOVSA-N |
| XLogP | 4.95 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|