C27H35N3O4S — CID 121427115
N-(4-ethylphenyl)-N,2-bis(oxan-4-ylmethyl)indazole-5-sulfonamide (PubChem CID 121427115) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is N-(4-ethylphenyl)-N,2-bis(oxan-4-ylmethyl)indazole-5-sulfonamide.
| Compound Name | N-(4-ethylphenyl)-N,2-bis(oxan-4-ylmethyl)indazole-5-sulfonamide |
|---|---|
| PubChem CID | 121427115 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-(4-ethylphenyl)-N,2-bis(oxan-4-ylmethyl)indazole-5-sulfonamide |
| SMILES | CCc1ccc(N(CC2CCOCC2)S(=O)(=O)c2ccc3nn(CC4CCOCC4)cc3c2)cc1 |
| InChI | InChI=1S/C27H35N3O4S/c1-2-21-3-5-25(6-4-21)30(19-23-11-15-34-16-12-23)35(31,32)26-7-8-27-24(17-26)20-29(28-27)18-22-9-13-33-14-10-22/h3-8,17,20,22-23H,2,9-16,18-19H2,1H3 |
| InChIKey | ODNOOCABAXYUFU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |