C24H30FN3O3S — CID 121427103
N-(2-fluoro-6-methylphenyl)-N-(2-methylpropyl)-2-(oxan-4-ylmethyl)indazole-5-sulfonamide (PubChem CID 121427103) has the molecular formula C24H30FN3O3S and a molecular weight of 459.59 g/mol. Its IUPAC name is N-(2-fluoro-6-methylphenyl)-N-(2-methylpropyl)-2-(oxan-4-ylmethyl)indazole-5-sulfonamide.
| Compound Name | N-(2-fluoro-6-methylphenyl)-N-(2-methylpropyl)-2-(oxan-4-ylmethyl)indazole-5-sulfonamide |
|---|---|
| PubChem CID | 121427103 |
| Molecular Formula | C24H30FN3O3S |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-(2-fluoro-6-methylphenyl)-N-(2-methylpropyl)-2-(oxan-4-ylmethyl)indazole-5-sulfonamide |
| SMILES | Cc1cccc(F)c1N(CC(C)C)S(=O)(=O)c1ccc2nn(CC3CCOCC3)cc2c1 |
| InChI | InChI=1S/C24H30FN3O3S/c1-17(2)14-28(24-18(3)5-4-6-22(24)25)32(29,30)21-7-8-23-20(13-21)16-27(26-23)15-19-9-11-31-12-10-19/h4-8,13,16-17,19H,9-12,14-15H2,1-3H3 |
| InChIKey | WMWDYFYVDOKDDX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |