C23H29F4N3O3S — CID 137446210
4-[amino(oxan-4-ylmethyl)amino]-3-fluoro-N-(2-methylpropyl)-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 137446210) has the molecular formula C23H29F4N3O3S and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-[amino(oxan-4-ylmethyl)amino]-3-fluoro-N-(2-methylpropyl)-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-[amino(oxan-4-ylmethyl)amino]-3-fluoro-N-(2-methylpropyl)-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 137446210 |
| Molecular Formula | C23H29F4N3O3S |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 4-[amino(oxan-4-ylmethyl)amino]-3-fluoro-N-(2-methylpropyl)-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | CC(C)CN(c1ccc(C(F)(F)F)cc1)S(=O)(=O)c1ccc(N(N)CC2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C23H29F4N3O3S/c1-16(2)14-30(19-5-3-18(4-6-19)23(25,26)27)34(31,32)20-7-8-22(21(24)13-20)29(28)15-17-9-11-33-12-10-17/h3-8,13,16-17H,9-12,14-15,28H2,1-2H3 |
| InChIKey | JBTAREDUGOVPDP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|