C25H31N3O3S — CID 145103017
N-(4-ethylphenyl)-2-(oxan-4-ylmethyl)-N-(oxetan-3-ylmethyl)indazole-5-sulfinamide (PubChem CID 145103017) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-(oxan-4-ylmethyl)-N-(oxetan-3-ylmethyl)indazole-5-sulfinamide.
| Compound Name | N-(4-ethylphenyl)-2-(oxan-4-ylmethyl)-N-(oxetan-3-ylmethyl)indazole-5-sulfinamide |
|---|---|
| PubChem CID | 145103017 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-(4-ethylphenyl)-2-(oxan-4-ylmethyl)-N-(oxetan-3-ylmethyl)indazole-5-sulfinamide |
| SMILES | CCc1ccc(N(CC2COC2)S(=O)c2ccc3nn(CC4CCOCC4)cc3c2)cc1 |
| InChI | InChI=1S/C25H31N3O3S/c1-2-19-3-5-23(6-4-19)28(15-21-17-31-18-21)32(29)24-7-8-25-22(13-24)16-27(26-25)14-20-9-11-30-12-10-20/h3-8,13,16,20-21H,2,9-12,14-15,17-18H2,1H3 |
| InChIKey | OGDARFOPPMUDMF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |