C31H36FN3O4 — CID 138742081
N-[(2R,3R,4E,6E)-4-ethenyl-3-hydroxy-7-propoxy-1-pyrrolidin-1-ylhepta-4,6-dien-2-yl]-7-(4-fluorophenyl)-1H-2,3-benzoxazine-4-carboxamide (PubChem CID 138742081) has the molecular formula C31H36FN3O4 and a molecular weight of 533.64 g/mol. Its IUPAC name is N-[(2R,3R,4E,6E)-4-ethenyl-3-hydroxy-7-propoxy-1-pyrrolidin-1-ylhepta-4,6-dien-2-yl]-7-(4-fluorophenyl)-1H-2,3-benzoxazine-4-carboxamide.
| Compound Name | N-[(2R,3R,4E,6E)-4-ethenyl-3-hydroxy-7-propoxy-1-pyrrolidin-1-ylhepta-4,6-dien-2-yl]-7-(4-fluorophenyl)-1H-2,3-benzoxazine-4-carboxamide |
|---|---|
| PubChem CID | 138742081 |
| Molecular Formula | C31H36FN3O4 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | N-[(2R,3R,4E,6E)-4-ethenyl-3-hydroxy-7-propoxy-1-pyrrolidin-1-ylhepta-4,6-dien-2-yl]-7-(4-fluorophenyl)-1H-2,3-benzoxazine-4-carboxamide |
| SMILES | C=C/C(=C\C=C\OCCC)[C@@H](O)[C@@H](CN1CCCC1)NC(=O)C1=NOCc2cc(-c3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C31H36FN3O4/c1-3-17-38-18-7-8-22(4-2)30(36)28(20-35-15-5-6-16-35)33-31(37)29-27-14-11-24(19-25(27)21-39-34-29)23-9-12-26(32)13-10-23/h4,7-14,18-19,28,30,36H,2-3,5-6,15-17,20-21H2,1H3,(H,33,37)/b18-7+,22-8+/t28-,30-/m1/s1 |
| InChIKey | UPOYHEXJMGXNIN-RMSPMYRWSA-N |
| XLogP | 4.72 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|