C16H12FNO2 — CID 122534530
6-(4-fluorophenyl)-3,4-dihydroisoquinoline-1-carboxylic acid (PubChem CID 122534530) has the molecular formula C16H12FNO2 and a molecular weight of 269.28 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-3,4-dihydroisoquinoline-1-carboxylic acid.
| Compound Name | 6-(4-fluorophenyl)-3,4-dihydroisoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 122534530 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 6-(4-fluorophenyl)-3,4-dihydroisoquinoline-1-carboxylic acid |
| SMILES | O=C(O)C1=NCCc2cc(-c3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C16H12FNO2/c17-13-4-1-10(2-5-13)11-3-6-14-12(9-11)7-8-18-15(14)16(19)20/h1-6,9H,7-8H2,(H,19,20) |
| InChIKey | PEIMQFYMPIKGML-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |