C18H16FNO2 — CID 122534532
ethyl 6-(4-fluorophenyl)-3,4-dihydroisoquinoline-1-carboxylate (PubChem CID 122534532) has the molecular formula C18H16FNO2 and a molecular weight of 297.33 g/mol. Its IUPAC name is ethyl 6-(4-fluorophenyl)-3,4-dihydroisoquinoline-1-carboxylate.
| Compound Name | ethyl 6-(4-fluorophenyl)-3,4-dihydroisoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 122534532 |
| Molecular Formula | C18H16FNO2 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | ethyl 6-(4-fluorophenyl)-3,4-dihydroisoquinoline-1-carboxylate |
| SMILES | CCOC(=O)C1=NCCc2cc(-c3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C18H16FNO2/c1-2-22-18(21)17-16-8-5-13(11-14(16)9-10-20-17)12-3-6-15(19)7-4-12/h3-8,11H,2,9-10H2,1H3 |
| InChIKey | BCIODGWQKZDHJH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |