C14H16FNO2 — CID 102279983
ethyl 6-fluoro-3,3-dimethyl-4H-isoquinoline-1-carboxylate (PubChem CID 102279983) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is ethyl 6-fluoro-3,3-dimethyl-4H-isoquinoline-1-carboxylate.
| Compound Name | ethyl 6-fluoro-3,3-dimethyl-4H-isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 102279983 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | ethyl 6-fluoro-3,3-dimethyl-4H-isoquinoline-1-carboxylate |
| SMILES | CCOC(=O)C1=NC(C)(C)Cc2cc(F)ccc21 |
| InChI | InChI=1S/C14H16FNO2/c1-4-18-13(17)12-11-6-5-10(15)7-9(11)8-14(2,3)16-12/h5-7H,4,8H2,1-3H3 |
| InChIKey | SFKWQGUPKIBUMT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |