C10H11ClN4O4 — CID 138743625
(2R,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbonitrile (PubChem CID 138743625) has the molecular formula C10H11ClN4O4 and a molecular weight of 286.68 g/mol. Its IUPAC name is (2R,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbonitrile.
| Compound Name | (2R,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 138743625 |
| Molecular Formula | C10H11ClN4O4 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (2R,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbonitrile |
| SMILES | N#C[C@]1(CO)OC[C@](Cl)(n2ccc(N)nc2=O)[C@@H]1O |
| InChI | InChI=1S/C10H11ClN4O4/c11-10(15-2-1-6(13)14-8(15)18)5-19-9(3-12,4-16)7(10)17/h1-2,7,16-17H,4-5H2,(H2,13,14,18)/t7-,9-,10+/m1/s1 |
| InChIKey | KBHRXHMVOLFVDF-QNSHHTMESA-N |
| XLogP | -1.64 |
| TPSA | 134.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|