About 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine
3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine (PubChem CID 138744418) has the molecular formula C15H16BrN5
and a molecular weight of 346.23 g/mol. Its IUPAC name is 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
| PubChem CID | 138744418 |
| Molecular Formula | C15H16BrN5 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1cnc(Br)cn1 |
| InChI | InChI=1S/C15H16BrN5/c1-4-13-20-14-9(2)5-10(3)19-15(14)21(13)8-11-6-18-12(16)7-17-11/h5-7H,4,8H2,1-3H3 |
| InChIKey | JSRDODQIBAHBOS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine?
The IUPAC name of 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine (CID 138744418) is 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine.
What is the SMILES notation for 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine?
The canonical SMILES for 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine is CCc1nc2c(C)cc(C)nc2n1Cc1cnc(Br)cn1.
What is the InChIKey of 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine?
The InChIKey is JSRDODQIBAHBOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrN5/c1-4-13-20-14-9(2)5-10(3)19-15(14)21(13)8-11-6-18-12(16)7-17-11/h5-7H,4,8H2,1-3H3.
What are the key properties of 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine?
3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine has a molecular weight of 346.23 g/mol, XLogP of 3.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-bromopyrazin-2-yl)methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine is sourced from PubChem (CID 138744418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).