C48H31N5 — CID 138746453
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2-diphenylnaphtho[1,2-e]benzimidazole (PubChem CID 138746453) has the molecular formula C48H31N5 and a molecular weight of 677.81 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2-diphenylnaphtho[1,2-e]benzimidazole.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2-diphenylnaphtho[1,2-e]benzimidazole |
|---|---|
| PubChem CID | 138746453 |
| Molecular Formula | C48H31N5 |
| Molecular Weight | 677.81 g/mol |
| Exact Mass | 677.26 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2-diphenylnaphtho[1,2-e]benzimidazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5c(ccc6ccc7nc(-c8ccccc8)n(-c8ccccc8)c7c65)c4)c3)n2)cc1 |
| InChI | InChI=1S/C48H31N5/c1-5-14-33(15-6-1)45-50-46(34-16-7-2-8-17-34)52-47(51-45)39-21-13-20-36(31-39)37-26-28-41-38(30-37)25-24-32-27-29-42-44(43(32)41)53(40-22-11-4-12-23-40)48(49-42)35-18-9-3-10-19-35/h1-31H |
| InChIKey | JMBUTRNLOWQGMG-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.81 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|