C12H11N3O — CID 138748384
3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentene-1-carbaldehyde (PubChem CID 138748384) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentene-1-carbaldehyde.
| Compound Name | 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentene-1-carbaldehyde |
|---|---|
| PubChem CID | 138748384 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentene-1-carbaldehyde |
| SMILES | O=CC1=CC(n2ccc3cncnc32)CC1 |
| InChI | InChI=1S/C12H11N3O/c16-7-9-1-2-11(5-9)15-4-3-10-6-13-8-14-12(10)15/h3-8,11H,1-2H2 |
| InChIKey | UIMCWRZSLPLHFR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|