C13H16N4O — CID 89339404
2-[(1S,3S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]acetaldehyde (PubChem CID 89339404) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-[(1S,3S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]acetaldehyde.
| Compound Name | 2-[(1S,3S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 89339404 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[(1S,3S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]acetaldehyde |
| SMILES | Nc1ncnc2c1ccn2[C@H]1CC[C@H](CC=O)C1 |
| InChI | InChI=1S/C13H16N4O/c14-12-11-3-5-17(13(11)16-8-15-12)10-2-1-9(7-10)4-6-18/h3,5-6,8-10H,1-2,4,7H2,(H2,14,15,16)/t9-,10+/m1/s1 |
| InChIKey | BVQZBZPJUGNNDS-ZJUUUORDSA-N |
| XLogP | 1.94 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|