C41H30N4 — CID 138750278
N-[2-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]-6-[(Z)-prop-1-enyl]phenyl]methanimine (PubChem CID 138750278) has the molecular formula C41H30N4 and a molecular weight of 578.72 g/mol. Its IUPAC name is N-[2-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]-6-[(Z)-prop-1-enyl]phenyl]methanimine.
| Compound Name | N-[2-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]-6-[(Z)-prop-1-enyl]phenyl]methanimine |
|---|---|
| PubChem CID | 138750278 |
| Molecular Formula | C41H30N4 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | N-[2-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]-6-[(Z)-prop-1-enyl]phenyl]methanimine |
| SMILES | C=Nc1c(/C=C\C)cccc1-c1ccc2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc2c1 |
| InChI | InChI=1S/C41H30N4/c1-3-11-30-16-10-17-37(38(30)42-2)35-25-21-29-20-24-34(26-36(29)27-35)28-18-22-33(23-19-28)41-44-39(31-12-6-4-7-13-31)43-40(45-41)32-14-8-5-9-15-32/h3-27H,2H2,1H3/b11-3- |
| InChIKey | DIGZJZZIPMIQAO-JYOAFUTRSA-N |
| XLogP | 10.73 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|