C16H32N2O9 — CID 138750474
(2S,4R)-4-[2-[2-(1,2,3,4,6-pentahydroxy-5-methylhexoxy)ethylamino]ethoxy]pyrrolidine-2-carboxylic acid (PubChem CID 138750474) has the molecular formula C16H32N2O9 and a molecular weight of 396.44 g/mol. Its IUPAC name is (2S,4R)-4-[2-[2-(1,2,3,4,6-pentahydroxy-5-methylhexoxy)ethylamino]ethoxy]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-[2-[2-(1,2,3,4,6-pentahydroxy-5-methylhexoxy)ethylamino]ethoxy]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 138750474 |
| Molecular Formula | C16H32N2O9 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | (2S,4R)-4-[2-[2-(1,2,3,4,6-pentahydroxy-5-methylhexoxy)ethylamino]ethoxy]pyrrolidine-2-carboxylic acid |
| SMILES | CC(CO)C(O)C(O)C(O)C(O)OCCNCCO[C@H]1CN[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C16H32N2O9/c1-9(8-19)12(20)13(21)14(22)16(25)27-5-3-17-2-4-26-10-6-11(15(23)24)18-7-10/h9-14,16-22,25H,2-8H2,1H3,(H,23,24)/t9?,10-,11+,12?,13?,14?,16?/m1/s1 |
| InChIKey | VKVSRACUDMGVJD-CSYRDQHDSA-N |
| XLogP | -3.55 |
| TPSA | 180.97 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|