C24H23N3O3S3 — CID 138750896
4-(2-methylprop-2-enyl)-5-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-11-pent-4-ynoyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 138750896) has the molecular formula C24H23N3O3S3 and a molecular weight of 497.67 g/mol. Its IUPAC name is 4-(2-methylprop-2-enyl)-5-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-11-pent-4-ynoyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-(2-methylprop-2-enyl)-5-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-11-pent-4-ynoyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 138750896 |
| Molecular Formula | C24H23N3O3S3 |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 4-(2-methylprop-2-enyl)-5-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-11-pent-4-ynoyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | C#CCCC(=O)N1CCc2c(sc3nc(SCC(=O)c4cccs4)n(CC(=C)C)c(=O)c23)C1 |
| InChI | InChI=1S/C24H23N3O3S3/c1-4-5-8-20(29)26-10-9-16-19(13-26)33-22-21(16)23(30)27(12-15(2)3)24(25-22)32-14-17(28)18-7-6-11-31-18/h1,6-7,11H,2,5,8-10,12-14H2,3H3 |
| InChIKey | NUEAGEVVXSVOIO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|