C28H24F3N5O3S3 — CID 138750689
4-(2-methylprop-2-enyl)-5-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-11-[4-[3-(trifluoromethyl)diaziridin-3-yl]benzoyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 138750689) has the molecular formula C28H24F3N5O3S3 and a molecular weight of 631.73 g/mol. Its IUPAC name is 4-(2-methylprop-2-enyl)-5-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-11-[4-[3-(trifluoromethyl)diaziridin-3-yl]benzoyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-(2-methylprop-2-enyl)-5-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-11-[4-[3-(trifluoromethyl)diaziridin-3-yl]benzoyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 138750689 |
| Molecular Formula | C28H24F3N5O3S3 |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.10 |
| IUPAC Name | 4-(2-methylprop-2-enyl)-5-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-11-[4-[3-(trifluoromethyl)diaziridin-3-yl]benzoyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | C=C(C)Cn1c(SCC(=O)c2cccs2)nc2sc3c(c2c1=O)CCN(C(=O)c1ccc(C2(C(F)(F)F)NN2)cc1)C3 |
| InChI | InChI=1S/C28H24F3N5O3S3/c1-15(2)12-36-25(39)22-18-9-10-35(24(38)16-5-7-17(8-6-16)27(33-34-27)28(29,30)31)13-21(18)42-23(22)32-26(36)41-14-19(37)20-4-3-11-40-20/h3-8,11,33-34H,1,9-10,12-14H2,2H3 |
| InChIKey | KVJUQXFGUPULMP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|