C32H30N2O3S2 — CID 130188532
2-(2-cyclopenta-1,3-dien-1-yl-2-oxoethyl)sulfanyl-7-[3-(1-methylcycloprop-2-en-1-yl)benzoyl]-3-(2-methylprop-2-enyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 130188532) has the molecular formula C32H30N2O3S2 and a molecular weight of 554.74 g/mol. Its IUPAC name is 2-(2-cyclopenta-1,3-dien-1-yl-2-oxoethyl)sulfanyl-7-[3-(1-methylcycloprop-2-en-1-yl)benzoyl]-3-(2-methylprop-2-enyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-cyclopenta-1,3-dien-1-yl-2-oxoethyl)sulfanyl-7-[3-(1-methylcycloprop-2-en-1-yl)benzoyl]-3-(2-methylprop-2-enyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 130188532 |
| Molecular Formula | C32H30N2O3S2 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 2-(2-cyclopenta-1,3-dien-1-yl-2-oxoethyl)sulfanyl-7-[3-(1-methylcycloprop-2-en-1-yl)benzoyl]-3-(2-methylprop-2-enyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=C(C)Cn1c(SCC(=O)C2=CC=CC2)nc2sc3c(c2c1=O)CCC(C(=O)c1cccc(C2(C)C=C2)c1)C3 |
| InChI | InChI=1S/C32H30N2O3S2/c1-19(2)17-34-30(37)27-24-12-11-22(28(36)21-9-6-10-23(15-21)32(3)13-14-32)16-26(24)39-29(27)33-31(34)38-18-25(35)20-7-4-5-8-20/h4-7,9-10,13-15,22H,1,8,11-12,16-18H2,2-3H3 |
| InChIKey | OLSKUECTWCAUPP-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|