C21H27ClN2O3 — CID 138752531
4-chloro-N-[[(1S,3S)-3-ethenyl-1-hydroxycyclohexyl]methyl]-1-(2-methoxyethyl)indole-3-carboxamide (PubChem CID 138752531) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is 4-chloro-N-[[(1S,3S)-3-ethenyl-1-hydroxycyclohexyl]methyl]-1-(2-methoxyethyl)indole-3-carboxamide.
| Compound Name | 4-chloro-N-[[(1S,3S)-3-ethenyl-1-hydroxycyclohexyl]methyl]-1-(2-methoxyethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 138752531 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-chloro-N-[[(1S,3S)-3-ethenyl-1-hydroxycyclohexyl]methyl]-1-(2-methoxyethyl)indole-3-carboxamide |
| SMILES | C=C[C@H]1CCC[C@@](O)(CNC(=O)c2cn(CCOC)c3cccc(Cl)c23)C1 |
| InChI | InChI=1S/C21H27ClN2O3/c1-3-15-6-5-9-21(26,12-15)14-23-20(25)16-13-24(10-11-27-2)18-8-4-7-17(22)19(16)18/h3-4,7-8,13,15,26H,1,5-6,9-12,14H2,2H3,(H,23,25)/t15-,21-/m0/s1 |
| InChIKey | AOZKEKPZTGJSBG-BTYIYWSLSA-N |
| XLogP | 3.78 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|