C20H18ClF3N2O4 — CID 175105200
4-chloro-1-(2-methoxyethyl)indole-3-carboxylic acid;2-(trifluoromethyl)benzamide (PubChem CID 175105200) has the molecular formula C20H18ClF3N2O4 and a molecular weight of 442.82 g/mol. Its IUPAC name is 4-chloro-1-(2-methoxyethyl)indole-3-carboxylic acid;2-(trifluoromethyl)benzamide.
| Compound Name | 4-chloro-1-(2-methoxyethyl)indole-3-carboxylic acid;2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 175105200 |
| Molecular Formula | C20H18ClF3N2O4 |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 4-chloro-1-(2-methoxyethyl)indole-3-carboxylic acid;2-(trifluoromethyl)benzamide |
| SMILES | COCCn1cc(C(=O)O)c2c(Cl)cccc21.NC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H12ClNO3.C8H6F3NO/c1-17-6-5-14-7-8(12(15)16)11-9(13)3-2-4-10(11)14;9-8(10,11)6-4-2-1-3-5(6)7(12)13/h2-4,7H,5-6H2,1H3,(H,15,16);1-4H,(H2,12,13) |
| InChIKey | NMCWYLHQSIDDSH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |