C17H20N2O5 — CID 67256324
1-(2-methoxyethyl)-4-(morpholine-4-carbonyl)indole-3-carboxylic acid (PubChem CID 67256324) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-(morpholine-4-carbonyl)indole-3-carboxylic acid.
| Compound Name | 1-(2-methoxyethyl)-4-(morpholine-4-carbonyl)indole-3-carboxylic acid |
|---|---|
| PubChem CID | 67256324 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-(2-methoxyethyl)-4-(morpholine-4-carbonyl)indole-3-carboxylic acid |
| SMILES | COCCn1cc(C(=O)O)c2c(C(=O)N3CCOCC3)cccc21 |
| InChI | InChI=1S/C17H20N2O5/c1-23-8-5-19-11-13(17(21)22)15-12(3-2-4-14(15)19)16(20)18-6-9-24-10-7-18/h2-4,11H,5-10H2,1H3,(H,21,22) |
| InChIKey | IOPLNQIRIJOBGG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |