C18H22F2N2O2 — CID 141303525
[7-(difluoromethyl)-1-(2-methoxyethyl)indol-3-yl]-piperidin-1-ylmethanone (PubChem CID 141303525) has the molecular formula C18H22F2N2O2 and a molecular weight of 336.38 g/mol. Its IUPAC name is [7-(difluoromethyl)-1-(2-methoxyethyl)indol-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [7-(difluoromethyl)-1-(2-methoxyethyl)indol-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 141303525 |
| Molecular Formula | C18H22F2N2O2 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [7-(difluoromethyl)-1-(2-methoxyethyl)indol-3-yl]-piperidin-1-ylmethanone |
| SMILES | COCCn1cc(C(=O)N2CCCCC2)c2cccc(C(F)F)c21 |
| InChI | InChI=1S/C18H22F2N2O2/c1-24-11-10-22-12-15(18(23)21-8-3-2-4-9-21)13-6-5-7-14(16(13)22)17(19)20/h5-7,12,17H,2-4,8-11H2,1H3 |
| InChIKey | YFFAVTICPIHSHG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |