C21H28ClN3O — CID 69490579
[7-chloro-1-(cyclohexylmethyl)indol-3-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 69490579) has the molecular formula C21H28ClN3O and a molecular weight of 373.93 g/mol. Its IUPAC name is [7-chloro-1-(cyclohexylmethyl)indol-3-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [7-chloro-1-(cyclohexylmethyl)indol-3-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 69490579 |
| Molecular Formula | C21H28ClN3O |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | [7-chloro-1-(cyclohexylmethyl)indol-3-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cn(CC3CCCCC3)c3c(Cl)cccc23)CC1 |
| InChI | InChI=1S/C21H28ClN3O/c1-23-10-12-24(13-11-23)21(26)18-15-25(14-16-6-3-2-4-7-16)20-17(18)8-5-9-19(20)22/h5,8-9,15-16H,2-4,6-7,10-14H2,1H3 |
| InChIKey | QXRNVSRTMBONDR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |