C22H31Cl2N3O — CID 118717936
[5-chloro-1-(cyclohexylmethyl)indol-3-yl]-(4-ethylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 118717936) has the molecular formula C22H31Cl2N3O and a molecular weight of 424.42 g/mol. Its IUPAC name is [5-chloro-1-(cyclohexylmethyl)indol-3-yl]-(4-ethylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | [5-chloro-1-(cyclohexylmethyl)indol-3-yl]-(4-ethylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 118717936 |
| Molecular Formula | C22H31Cl2N3O |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [5-chloro-1-(cyclohexylmethyl)indol-3-yl]-(4-ethylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CCN1CCN(C(=O)c2cn(CC3CCCCC3)c3ccc(Cl)cc23)CC1.Cl |
| InChI | InChI=1S/C22H30ClN3O.ClH/c1-2-24-10-12-25(13-11-24)22(27)20-16-26(15-17-6-4-3-5-7-17)21-9-8-18(23)14-19(20)21;/h8-9,14,16-17H,2-7,10-13,15H2,1H3;1H |
| InChIKey | GPVZAERKQDFRNW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |