C22H28N4O — CID 69488577
1-(cyclohexylmethyl)-3-(4-methylpiperazine-1-carbonyl)indole-6-carbonitrile (PubChem CID 69488577) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-(4-methylpiperazine-1-carbonyl)indole-6-carbonitrile.
| Compound Name | 1-(cyclohexylmethyl)-3-(4-methylpiperazine-1-carbonyl)indole-6-carbonitrile |
|---|---|
| PubChem CID | 69488577 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-(4-methylpiperazine-1-carbonyl)indole-6-carbonitrile |
| SMILES | CN1CCN(C(=O)c2cn(CC3CCCCC3)c3cc(C#N)ccc23)CC1 |
| InChI | InChI=1S/C22H28N4O/c1-24-9-11-25(12-10-24)22(27)20-16-26(15-17-5-3-2-4-6-17)21-13-18(14-23)7-8-19(20)21/h7-8,13,16-17H,2-6,9-12,15H2,1H3 |
| InChIKey | RYAKKMVPKFMZBD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |