C16H20ClNO2 — CID 67637530
1-(cyclopentylmethyl)-3-methylindole-6-carboxylic acid;hydrochloride (PubChem CID 67637530) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-3-methylindole-6-carboxylic acid;hydrochloride.
| Compound Name | 1-(cyclopentylmethyl)-3-methylindole-6-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67637530 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(cyclopentylmethyl)-3-methylindole-6-carboxylic acid;hydrochloride |
| SMILES | Cc1cn(CC2CCCC2)c2cc(C(=O)O)ccc12.Cl |
| InChI | InChI=1S/C16H19NO2.ClH/c1-11-9-17(10-12-4-2-3-5-12)15-8-13(16(18)19)6-7-14(11)15;/h6-9,12H,2-5,10H2,1H3,(H,18,19);1H |
| InChIKey | ILFKZQOVRVJGAU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |