C24H32N2O4 — CID 67628010
tert-butyl 3-[3-methyl-1-(oxan-2-ylmethyl)indol-6-yl]-2-oxopyrrolidine-1-carboxylate (PubChem CID 67628010) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is tert-butyl 3-[3-methyl-1-(oxan-2-ylmethyl)indol-6-yl]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-methyl-1-(oxan-2-ylmethyl)indol-6-yl]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67628010 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | tert-butyl 3-[3-methyl-1-(oxan-2-ylmethyl)indol-6-yl]-2-oxopyrrolidine-1-carboxylate |
| SMILES | Cc1cn(CC2CCCCO2)c2cc(C3CCN(C(=O)OC(C)(C)C)C3=O)ccc12 |
| InChI | InChI=1S/C24H32N2O4/c1-16-14-25(15-18-7-5-6-12-29-18)21-13-17(8-9-19(16)21)20-10-11-26(22(20)27)23(28)30-24(2,3)4/h8-9,13-14,18,20H,5-7,10-12,15H2,1-4H3 |
| InChIKey | IXJCBCHWDXKSJJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|