C21H28BrN3O — CID 69491353
[6-bromo-1-(cyclohexylmethyl)indol-3-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 69491353) has the molecular formula C21H28BrN3O and a molecular weight of 418.38 g/mol. Its IUPAC name is [6-bromo-1-(cyclohexylmethyl)indol-3-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [6-bromo-1-(cyclohexylmethyl)indol-3-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 69491353 |
| Molecular Formula | C21H28BrN3O |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [6-bromo-1-(cyclohexylmethyl)indol-3-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cn(CC3CCCCC3)c3cc(Br)ccc23)CC1 |
| InChI | InChI=1S/C21H28BrN3O/c1-23-9-11-24(12-10-23)21(26)19-15-25(14-16-5-3-2-4-6-16)20-13-17(22)7-8-18(19)20/h7-8,13,15-16H,2-6,9-12,14H2,1H3 |
| InChIKey | BIWZFBGZKMCACN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |