C25H35N3O2 — CID 52949820
[(8aS)-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone (PubChem CID 52949820) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is [(8aS)-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone.
| Compound Name | [(8aS)-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone |
|---|---|
| PubChem CID | 52949820 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | [(8aS)-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone |
| SMILES | COc1cccc2c(C(=O)N3CCN4CCC[C@@]4(C)C3)cn(CC3CCCCC3)c12 |
| InChI | InChI=1S/C25H35N3O2/c1-25-12-7-13-28(25)15-14-26(18-25)24(29)21-17-27(16-19-8-4-3-5-9-19)23-20(21)10-6-11-22(23)30-2/h6,10-11,17,19H,3-5,7-9,12-16,18H2,1-2H3/t25-/m0/s1 |
| InChIKey | HMMODIVNRVDSSA-VWLOTQADSA-N |
| XLogP | 4.54 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |