C25H36ClN3O2S — CID 52946150
[(6S,8aR)-6,8a-dimethyl-3,5,6,8-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazin-7-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride (PubChem CID 52946150) has the molecular formula C25H36ClN3O2S and a molecular weight of 478.10 g/mol. Its IUPAC name is [(6S,8aR)-6,8a-dimethyl-3,5,6,8-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazin-7-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride.
| Compound Name | [(6S,8aR)-6,8a-dimethyl-3,5,6,8-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazin-7-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 52946150 |
| Molecular Formula | C25H36ClN3O2S |
| Molecular Weight | 478.10 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | [(6S,8aR)-6,8a-dimethyl-3,5,6,8-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazin-7-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride |
| SMILES | COc1cccc2c(C(=O)N3C[C@]4(C)CSCN4C[C@@H]3C)cn(CC3CCCCC3)c12.Cl |
| InChI | InChI=1S/C25H35N3O2S.ClH/c1-18-12-27-17-31-16-25(27,2)15-28(18)24(29)21-14-26(13-19-8-5-4-6-9-19)23-20(21)10-7-11-22(23)30-3;/h7,10-11,14,18-19H,4-6,8-9,12-13,15-17H2,1-3H3;1H/t18-,25+;/m0./s1 |
| InChIKey | GOMIDTFVHGKBCD-CDAQVASYSA-N |
| XLogP | 5.26 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.10 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |