C21H29ClN2O3 — CID 155769816
[9a-methyl-7-(2-methylprop-2-enoxy)-3,4,6,7,8,9-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methoxyphenyl)methanone (PubChem CID 155769816) has the molecular formula C21H29ClN2O3 and a molecular weight of 392.93 g/mol. Its IUPAC name is [9a-methyl-7-(2-methylprop-2-enoxy)-3,4,6,7,8,9-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methoxyphenyl)methanone.
| Compound Name | [9a-methyl-7-(2-methylprop-2-enoxy)-3,4,6,7,8,9-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 155769816 |
| Molecular Formula | C21H29ClN2O3 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | [9a-methyl-7-(2-methylprop-2-enoxy)-3,4,6,7,8,9-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methoxyphenyl)methanone |
| SMILES | C=C(C)COC1CCC2(C)CN(C(=O)c3cccc(OC)c3Cl)CCN2C1 |
| InChI | InChI=1S/C21H29ClN2O3/c1-15(2)13-27-16-8-9-21(3)14-23(10-11-24(21)12-16)20(25)17-6-5-7-18(26-4)19(17)22/h5-7,16H,1,8-14H2,2-4H3 |
| InChIKey | FXUDGBMOXGRPLR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|