C17H20N2O5 — CID 125133249
(3R)-4-[1-(2-methoxyethyl)indole-3-carbonyl]morpholine-3-carboxylic acid (PubChem CID 125133249) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is (3R)-4-[1-(2-methoxyethyl)indole-3-carbonyl]morpholine-3-carboxylic acid.
| Compound Name | (3R)-4-[1-(2-methoxyethyl)indole-3-carbonyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 125133249 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (3R)-4-[1-(2-methoxyethyl)indole-3-carbonyl]morpholine-3-carboxylic acid |
| SMILES | COCCn1cc(C(=O)N2CCOC[C@@H]2C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C17H20N2O5/c1-23-8-6-18-10-13(12-4-2-3-5-14(12)18)16(20)19-7-9-24-11-15(19)17(21)22/h2-5,10,15H,6-9,11H2,1H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | JCPHTNLHKMGZTD-OAHLLOKOSA-N |
| XLogP | 1.21 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |