C27H22F3N6O4+ — CID 138752644
1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[2-phenyl-3-(trifluoromethyl)-1H-pyrazol-2-ium-5-yl]urea (PubChem CID 138752644) has the molecular formula C27H22F3N6O4+ and a molecular weight of 551.51 g/mol. Its IUPAC name is 1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[2-phenyl-3-(trifluoromethyl)-1H-pyrazol-2-ium-5-yl]urea.
| Compound Name | 1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[2-phenyl-3-(trifluoromethyl)-1H-pyrazol-2-ium-5-yl]urea |
|---|---|
| PubChem CID | 138752644 |
| Molecular Formula | C27H22F3N6O4+ |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | 1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[2-phenyl-3-(trifluoromethyl)-1H-pyrazol-2-ium-5-yl]urea |
| SMILES | COc1cc2ncnc(Oc3cccc(NC(=O)Nc4cc(C(F)(F)F)[n+](-c5ccccc5)[nH]4)c3)c2cc1OC |
| InChI | InChI=1S/C27H21F3N6O4/c1-38-21-12-19-20(13-22(21)39-2)31-15-32-25(19)40-18-10-6-7-16(11-18)33-26(37)34-24-14-23(27(28,29)30)36(35-24)17-8-4-3-5-9-17/h3-15H,1-2H3,(H2,33,34,35,37)/p+1 |
| InChIKey | HPDGAFQPXCINAQ-UHFFFAOYSA-O |
| XLogP | 5.71 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|