C19H19NO2 — CID 138753462
2-(anthracen-9-ylmethylideneamino)-2-methylpropane-1,3-diol (PubChem CID 138753462) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-(anthracen-9-ylmethylideneamino)-2-methylpropane-1,3-diol.
| Compound Name | 2-(anthracen-9-ylmethylideneamino)-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 138753462 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-(anthracen-9-ylmethylideneamino)-2-methylpropane-1,3-diol |
| SMILES | CC(CO)(CO)/N=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H19NO2/c1-19(12-21,13-22)20-11-18-16-8-4-2-6-14(16)10-15-7-3-5-9-17(15)18/h2-11,21-22H,12-13H2,1H3/b20-11+ |
| InChIKey | YHWMURSVOAEBHR-RGVLZGJSSA-N |
| XLogP | 3.16 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|