C14H7Cl2NO3 — CID 138754408
3-(2,5-dichlorophenyl)-1,3-benzoxazine-2,4-dione (PubChem CID 138754408) has the molecular formula C14H7Cl2NO3 and a molecular weight of 308.12 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-1,3-benzoxazine-2,4-dione.
| Compound Name | 3-(2,5-dichlorophenyl)-1,3-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 138754408 |
| Molecular Formula | C14H7Cl2NO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-1,3-benzoxazine-2,4-dione |
| SMILES | O=c1oc2ccccc2c(=O)n1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H7Cl2NO3/c15-8-5-6-10(16)11(7-8)17-13(18)9-3-1-2-4-12(9)20-14(17)19/h1-7H |
| InChIKey | DRRLUXNKOSAJTJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |