C20H12Cl2N2O2 — CID 10500149
3-(4-chlorophenyl)-2-(4-chlorophenyl)imino-1,3-benzoxazin-4-one (PubChem CID 10500149) has the molecular formula C20H12Cl2N2O2 and a molecular weight of 383.23 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(4-chlorophenyl)imino-1,3-benzoxazin-4-one.
| Compound Name | 3-(4-chlorophenyl)-2-(4-chlorophenyl)imino-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 10500149 |
| Molecular Formula | C20H12Cl2N2O2 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(4-chlorophenyl)imino-1,3-benzoxazin-4-one |
| SMILES | O=c1c2ccccc2o/c(=N\c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H12Cl2N2O2/c21-13-5-9-15(10-6-13)23-20-24(16-11-7-14(22)8-12-16)19(25)17-3-1-2-4-18(17)26-20/h1-12H/b23-20- |
| InChIKey | VSHMQGAHAKYPOZ-ATJXCDBQSA-N |
| XLogP | 5.12 |
| TPSA | 47.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |