C21H16N2O2 — CID 14867409
3-benzyl-2-phenylimino-1,3-benzoxazin-4-one (PubChem CID 14867409) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-benzyl-2-phenylimino-1,3-benzoxazin-4-one.
| Compound Name | 3-benzyl-2-phenylimino-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 14867409 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 3-benzyl-2-phenylimino-1,3-benzoxazin-4-one |
| SMILES | O=c1c2ccccc2o/c(=N\c2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H16N2O2/c24-20-18-13-7-8-14-19(18)25-21(22-17-11-5-2-6-12-17)23(20)15-16-9-3-1-4-10-16/h1-14H,15H2/b22-21- |
| InChIKey | IQUUCTXKAVONQH-DQRAZIAOSA-N |
| XLogP | 3.88 |
| TPSA | 47.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |