C11H10F4OS — CID 138756099
1-(4-ethylsulfanylphenyl)-2,2,3,3-tetrafluoropropan-1-one (PubChem CID 138756099) has the molecular formula C11H10F4OS and a molecular weight of 266.26 g/mol. Its IUPAC name is 1-(4-ethylsulfanylphenyl)-2,2,3,3-tetrafluoropropan-1-one.
| Compound Name | 1-(4-ethylsulfanylphenyl)-2,2,3,3-tetrafluoropropan-1-one |
|---|---|
| PubChem CID | 138756099 |
| Molecular Formula | C11H10F4OS |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-(4-ethylsulfanylphenyl)-2,2,3,3-tetrafluoropropan-1-one |
| SMILES | CCSc1ccc(C(=O)C(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C11H10F4OS/c1-2-17-8-5-3-7(4-6-8)9(16)11(14,15)10(12)13/h3-6,10H,2H2,1H3 |
| InChIKey | OKVUUZUDSTXBKO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|