C26H19FN2O3 — CID 138756604
3-(4-fluorophenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-yl-2H-pyridin-1-yl]methyl]chromen-2-one (PubChem CID 138756604) has the molecular formula C26H19FN2O3 and a molecular weight of 426.45 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-yl-2H-pyridin-1-yl]methyl]chromen-2-one.
| Compound Name | 3-(4-fluorophenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-yl-2H-pyridin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 138756604 |
| Molecular Formula | C26H19FN2O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3-(4-fluorophenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-yl-2H-pyridin-1-yl]methyl]chromen-2-one |
| SMILES | O=c1oc2c(CN3C=CC=C[C@H]3c3cccnc3)c(O)ccc2cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H19FN2O3/c27-20-9-6-17(7-10-20)21-14-18-8-11-24(30)22(25(18)32-26(21)31)16-29-13-2-1-5-23(29)19-4-3-12-28-15-19/h1-15,23,30H,16H2/t23-/m0/s1 |
| InChIKey | NHWMADOALJQUCI-QHCPKHFHSA-N |
| XLogP | 5.33 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|