C35H25N5S — CID 138756650
3,5-diphenyl-N-(1,3,4-triphenylpyrazol-5-yl)-1,3,4-thiadiazol-2-imine (PubChem CID 138756650) has the molecular formula C35H25N5S and a molecular weight of 547.69 g/mol. Its IUPAC name is 3,5-diphenyl-N-(1,3,4-triphenylpyrazol-5-yl)-1,3,4-thiadiazol-2-imine.
| Compound Name | 3,5-diphenyl-N-(1,3,4-triphenylpyrazol-5-yl)-1,3,4-thiadiazol-2-imine |
|---|---|
| PubChem CID | 138756650 |
| Molecular Formula | C35H25N5S |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 3,5-diphenyl-N-(1,3,4-triphenylpyrazol-5-yl)-1,3,4-thiadiazol-2-imine |
| SMILES | c1ccc(-c2nn(-c3ccccc3)c(=Nc3c(-c4ccccc4)c(-c4ccccc4)nn3-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C35H25N5S/c1-6-16-26(17-7-1)31-32(27-18-8-2-9-19-27)37-39(29-22-12-4-13-23-29)33(31)36-35-40(30-24-14-5-15-25-30)38-34(41-35)28-20-10-3-11-21-28/h1-25H |
| InChIKey | VMSIEPXBGTUUJP-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |